C14H14IN3S — CID 43773323
N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3-iodoaniline (PubChem CID 43773323) has the molecular formula C14H14IN3S and a molecular weight of 383.26 g/mol. Its IUPAC name is N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3-iodoaniline.
| Compound Name | N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3-iodoaniline |
|---|---|
| PubChem CID | 43773323 |
| Molecular Formula | C14H14IN3S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3-iodoaniline |
| SMILES | Cc1nc2scc(C)n2c1CNc1cccc(I)c1 |
| InChI | InChI=1S/C14H14IN3S/c1-9-8-19-14-17-10(2)13(18(9)14)7-16-12-5-3-4-11(15)6-12/h3-6,8,16H,7H2,1-2H3 |
| InChIKey | AYKKWYJNFDTDTM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|