C12H18N4O3S — CID 107237222
tert-butyl N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]carbamate (PubChem CID 107237222) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is tert-butyl N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]carbamate.
| Compound Name | tert-butyl N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]carbamate |
|---|---|
| PubChem CID | 107237222 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | tert-butyl N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]carbamate |
| SMILES | COc1nc2sccn2c1CNNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H18N4O3S/c1-12(2,3)19-11(17)15-13-7-8-9(18-4)14-10-16(8)5-6-20-10/h5-6,13H,7H2,1-4H3,(H,15,17) |
| InChIKey | LNDNZRPQWJIXSD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|