C10H15N3O2S — CID 43756272
2-methoxy-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine (PubChem CID 43756272) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-methoxy-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine.
| Compound Name | 2-methoxy-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 43756272 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-methoxy-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine |
| SMILES | COCCNCc1c(OC)nc2sccn12 |
| InChI | InChI=1S/C10H15N3O2S/c1-14-5-3-11-7-8-9(15-2)12-10-13(8)4-6-16-10/h4,6,11H,3,5,7H2,1-2H3 |
| InChIKey | UDMJSUANKUPVJR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|