C10H12F3N3OS — CID 63226560
3,3,3-trifluoro-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]propan-1-amine (PubChem CID 63226560) has the molecular formula C10H12F3N3OS and a molecular weight of 279.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]propan-1-amine.
| Compound Name | 3,3,3-trifluoro-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 63226560 |
| Molecular Formula | C10H12F3N3OS |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3,3,3-trifluoro-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]propan-1-amine |
| SMILES | COc1nc2sccn2c1CNCCC(F)(F)F |
| InChI | InChI=1S/C10H12F3N3OS/c1-17-8-7(6-14-3-2-10(11,12)13)16-4-5-18-9(16)15-8/h4-5,14H,2-3,6H2,1H3 |
| InChIKey | JWHCVTKNJHSQDL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|