C11H18N4O3S2 — CID 106334575
N-ethyl-2-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethanesulfonamide (PubChem CID 106334575) has the molecular formula C11H18N4O3S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-ethyl-2-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethanesulfonamide.
| Compound Name | N-ethyl-2-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 106334575 |
| Molecular Formula | C11H18N4O3S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-ethyl-2-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNCc1c(OC)nc2sccn12 |
| InChI | InChI=1S/C11H18N4O3S2/c1-3-13-20(16,17)7-4-12-8-9-10(18-2)14-11-15(9)5-6-19-11/h5-6,12-13H,3-4,7-8H2,1-2H3 |
| InChIKey | KQBSDQUEOZRRLK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|