C11H8Cl2N4O2S2 — CID 103744918
6-chloro-N-(6-chloro-5-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 103744918) has the molecular formula C11H8Cl2N4O2S2 and a molecular weight of 363.25 g/mol. Its IUPAC name is 6-chloro-N-(6-chloro-5-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-chloro-N-(6-chloro-5-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103744918 |
| Molecular Formula | C11H8Cl2N4O2S2 |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 6-chloro-N-(6-chloro-5-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2c(Cl)nc3sccn23)cnc1Cl |
| InChI | InChI=1S/C11H8Cl2N4O2S2/c1-6-4-7(5-14-8(6)12)16-21(18,19)10-9(13)15-11-17(10)2-3-20-11/h2-5,16H,1H3 |
| InChIKey | XMUTVRGUSYQRCY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|