C27H24F3NO4S — CID 70664529
3-[[1-(3-tert-butylphenyl)sulfonyl-5-(trifluoromethyl)indol-2-yl]methyl]benzoic acid (PubChem CID 70664529) has the molecular formula C27H24F3NO4S and a molecular weight of 515.55 g/mol. Its IUPAC name is 3-[[1-(3-tert-butylphenyl)sulfonyl-5-(trifluoromethyl)indol-2-yl]methyl]benzoic acid.
| Compound Name | 3-[[1-(3-tert-butylphenyl)sulfonyl-5-(trifluoromethyl)indol-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 70664529 |
| Molecular Formula | C27H24F3NO4S |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 3-[[1-(3-tert-butylphenyl)sulfonyl-5-(trifluoromethyl)indol-2-yl]methyl]benzoic acid |
| SMILES | CC(C)(C)c1cccc(S(=O)(=O)n2c(Cc3cccc(C(=O)O)c3)cc3cc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C27H24F3NO4S/c1-26(2,3)20-8-5-9-23(16-20)36(34,35)31-22(13-17-6-4-7-18(12-17)25(32)33)15-19-14-21(27(28,29)30)10-11-24(19)31/h4-12,14-16H,13H2,1-3H3,(H,32,33) |
| InChIKey | HXYYTZYTOVNNBV-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |