C25H20F3NO5S2 — CID 162568202
1-[1-(3-tert-butylphenyl)sulfonyl-5-(trifluoromethyl)indole-2-carbonyl]thiophen-1-ium-2-carboxylate (PubChem CID 162568202) has the molecular formula C25H20F3NO5S2 and a molecular weight of 535.57 g/mol. Its IUPAC name is 1-[1-(3-tert-butylphenyl)sulfonyl-5-(trifluoromethyl)indole-2-carbonyl]thiophen-1-ium-2-carboxylate.
| Compound Name | 1-[1-(3-tert-butylphenyl)sulfonyl-5-(trifluoromethyl)indole-2-carbonyl]thiophen-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 162568202 |
| Molecular Formula | C25H20F3NO5S2 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | 1-[1-(3-tert-butylphenyl)sulfonyl-5-(trifluoromethyl)indole-2-carbonyl]thiophen-1-ium-2-carboxylate |
| SMILES | CC(C)(C)c1cccc(S(=O)(=O)n2c(C(=O)[s+]3cccc3C(=O)[O-])cc3cc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C25H20F3NO5S2/c1-24(2,3)16-6-4-7-18(14-16)36(33,34)29-19-10-9-17(25(26,27)28)12-15(19)13-20(29)23(32)35-11-5-8-21(35)22(30)31/h4-14H,1-3H3 |
| InChIKey | JNADREKACALZNV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 96.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|