C18H13F3NO3- — CID 154079979
5-methoxy-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylate (PubChem CID 154079979) has the molecular formula C18H13F3NO3- and a molecular weight of 348.30 g/mol. Its IUPAC name is 5-methoxy-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylate.
| Compound Name | 5-methoxy-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 154079979 |
| Molecular Formula | C18H13F3NO3- |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 5-methoxy-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylate |
| SMILES | COc1ccc2c(c1)cc(C(=O)[O-])n2Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F3NO3/c1-25-14-5-6-15-12(8-14)9-16(17(23)24)22(15)10-11-3-2-4-13(7-11)18(19,20)21/h2-9H,10H2,1H3,(H,23,24)/p-1 |
| InChIKey | FGASBQPXBWCFPH-UHFFFAOYSA-M |
| XLogP | 3.08 |
| TPSA | 54.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |