C20H18F3NO3 — CID 68699963
ethyl 5-methoxy-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylate (PubChem CID 68699963) has the molecular formula C20H18F3NO3 and a molecular weight of 377.36 g/mol. Its IUPAC name is ethyl 5-methoxy-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylate.
| Compound Name | ethyl 5-methoxy-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 68699963 |
| Molecular Formula | C20H18F3NO3 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | ethyl 5-methoxy-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(OC)ccc2n1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F3NO3/c1-3-27-19(25)18-11-14-10-16(26-2)7-8-17(14)24(18)12-13-5-4-6-15(9-13)20(21,22)23/h4-11H,3,12H2,1-2H3 |
| InChIKey | MKCDVISVLXDHID-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |