C15H17NO3 — CID 71427681
ethyl 5-methoxy-1-prop-2-enylindole-2-carboxylate (PubChem CID 71427681) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is ethyl 5-methoxy-1-prop-2-enylindole-2-carboxylate.
| Compound Name | ethyl 5-methoxy-1-prop-2-enylindole-2-carboxylate |
|---|---|
| PubChem CID | 71427681 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | ethyl 5-methoxy-1-prop-2-enylindole-2-carboxylate |
| SMILES | C=CCn1c(C(=O)OCC)cc2cc(OC)ccc21 |
| InChI | InChI=1S/C15H17NO3/c1-4-8-16-13-7-6-12(18-3)9-11(13)10-14(16)15(17)19-5-2/h4,6-7,9-10H,1,5,8H2,2-3H3 |
| InChIKey | SDEWFXCPSZMILH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|