C14H14N2O2 — CID 14595499
ethyl 1-(cyanomethyl)-5-methylindole-2-carboxylate (PubChem CID 14595499) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is ethyl 1-(cyanomethyl)-5-methylindole-2-carboxylate.
| Compound Name | ethyl 1-(cyanomethyl)-5-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 14595499 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | ethyl 1-(cyanomethyl)-5-methylindole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(C)ccc2n1CC#N |
| InChI | InChI=1S/C14H14N2O2/c1-3-18-14(17)13-9-11-8-10(2)4-5-12(11)16(13)7-6-15/h4-5,8-9H,3,7H2,1-2H3 |
| InChIKey | QEUVMNHSUROJSV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |