C21H20N4O4S — CID 176891642
ethyl 1-(cyanomethyl)-5-[(E)-[(2-methylphenyl)sulfonylhydrazinylidene]methyl]indole-2-carboxylate (PubChem CID 176891642) has the molecular formula C21H20N4O4S and a molecular weight of 424.48 g/mol. Its IUPAC name is ethyl 1-(cyanomethyl)-5-[(E)-[(2-methylphenyl)sulfonylhydrazinylidene]methyl]indole-2-carboxylate.
| Compound Name | ethyl 1-(cyanomethyl)-5-[(E)-[(2-methylphenyl)sulfonylhydrazinylidene]methyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 176891642 |
| Molecular Formula | C21H20N4O4S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | ethyl 1-(cyanomethyl)-5-[(E)-[(2-methylphenyl)sulfonylhydrazinylidene]methyl]indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(/C=N/NS(=O)(=O)c3ccccc3C)ccc2n1CC#N |
| InChI | InChI=1S/C21H20N4O4S/c1-3-29-21(26)19-13-17-12-16(8-9-18(17)25(19)11-10-22)14-23-24-30(27,28)20-7-5-4-6-15(20)2/h4-9,12-14,24H,3,11H2,1-2H3/b23-14+ |
| InChIKey | YPCFMEGFGXSSBU-OEAKJJBVSA-N |
| XLogP | 2.96 |
| TPSA | 113.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|