C19H20N2O4S — CID 164612993
ethyl 1-(2-phenylethyl)-5-sulfamoylindole-2-carboxylate (PubChem CID 164612993) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is ethyl 1-(2-phenylethyl)-5-sulfamoylindole-2-carboxylate.
| Compound Name | ethyl 1-(2-phenylethyl)-5-sulfamoylindole-2-carboxylate |
|---|---|
| PubChem CID | 164612993 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | ethyl 1-(2-phenylethyl)-5-sulfamoylindole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(S(N)(=O)=O)ccc2n1CCc1ccccc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-2-25-19(22)18-13-15-12-16(26(20,23)24)8-9-17(15)21(18)11-10-14-6-4-3-5-7-14/h3-9,12-13H,2,10-11H2,1H3,(H2,20,23,24) |
| InChIKey | PUCBAFJGGSMHCO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |