C18H15F2NO2 — CID 143638283
ethyl 1-[(3,5-difluorophenyl)methyl]indole-2-carboxylate (PubChem CID 143638283) has the molecular formula C18H15F2NO2 and a molecular weight of 315.32 g/mol. Its IUPAC name is ethyl 1-[(3,5-difluorophenyl)methyl]indole-2-carboxylate.
| Compound Name | ethyl 1-[(3,5-difluorophenyl)methyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 143638283 |
| Molecular Formula | C18H15F2NO2 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | ethyl 1-[(3,5-difluorophenyl)methyl]indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2ccccc2n1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H15F2NO2/c1-2-23-18(22)17-9-13-5-3-4-6-16(13)21(17)11-12-7-14(19)10-15(20)8-12/h3-10H,2,11H2,1H3 |
| InChIKey | DVXYMRQPWMZUHQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |