C15H13FN2O2S — CID 15978861
ethyl 5-fluoro-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate (PubChem CID 15978861) has the molecular formula C15H13FN2O2S and a molecular weight of 304.35 g/mol. Its IUPAC name is ethyl 5-fluoro-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate.
| Compound Name | ethyl 5-fluoro-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 15978861 |
| Molecular Formula | C15H13FN2O2S |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | ethyl 5-fluoro-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(F)ccc2n1Cc1nccs1 |
| InChI | InChI=1S/C15H13FN2O2S/c1-2-20-15(19)13-8-10-7-11(16)3-4-12(10)18(13)9-14-17-5-6-21-14/h3-8H,2,9H2,1H3 |
| InChIKey | UINFXZLHOIUTKR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |