C19H17NO5 — CID 101012963
ethyl 1-(1,3-benzodioxol-5-yl)-5-methoxyindole-2-carboxylate (PubChem CID 101012963) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is ethyl 1-(1,3-benzodioxol-5-yl)-5-methoxyindole-2-carboxylate.
| Compound Name | ethyl 1-(1,3-benzodioxol-5-yl)-5-methoxyindole-2-carboxylate |
|---|---|
| PubChem CID | 101012963 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | ethyl 1-(1,3-benzodioxol-5-yl)-5-methoxyindole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(OC)ccc2n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H17NO5/c1-3-23-19(21)16-9-12-8-14(22-2)5-6-15(12)20(16)13-4-7-17-18(10-13)25-11-24-17/h4-10H,3,11H2,1-2H3 |
| InChIKey | GDIXUHXCIBRUTI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |