C26H33N3O3 — CID 20801220
5-methoxy-1-[(3-methoxyphenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide (PubChem CID 20801220) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 5-methoxy-1-[(3-methoxyphenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide.
| Compound Name | 5-methoxy-1-[(3-methoxyphenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 20801220 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 5-methoxy-1-[(3-methoxyphenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide |
| SMILES | COc1cccc(Cn2c(C(=O)NC3CCN(C(C)C)CC3)cc3cc(OC)ccc32)c1 |
| InChI | InChI=1S/C26H33N3O3/c1-18(2)28-12-10-21(11-13-28)27-26(30)25-16-20-15-23(32-4)8-9-24(20)29(25)17-19-6-5-7-22(14-19)31-3/h5-9,14-16,18,21H,10-13,17H2,1-4H3,(H,27,30) |
| InChIKey | OVGNNEOTSYEFRR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |