C20H29N3OS — CID 142244509
1-ethyl-5-methylsulfanyl-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide (PubChem CID 142244509) has the molecular formula C20H29N3OS and a molecular weight of 359.54 g/mol. Its IUPAC name is 1-ethyl-5-methylsulfanyl-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide.
| Compound Name | 1-ethyl-5-methylsulfanyl-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 142244509 |
| Molecular Formula | C20H29N3OS |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-ethyl-5-methylsulfanyl-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide |
| SMILES | CCn1c(C(=O)NC2CCN(C(C)C)CC2)cc2cc(SC)ccc21 |
| InChI | InChI=1S/C20H29N3OS/c1-5-23-18-7-6-17(25-4)12-15(18)13-19(23)20(24)21-16-8-10-22(11-9-16)14(2)3/h6-7,12-14,16H,5,8-11H2,1-4H3,(H,21,24) |
| InChIKey | YYMGWPCZSSGISC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |