About 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide
1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide (PubChem CID 20801035) has the molecular formula C24H27Cl2N3O
and a molecular weight of 444.41 g/mol. Its IUPAC name is 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide.
Molecular Properties
| Compound Name | 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide |
| PubChem CID | 20801035 |
| Molecular Formula | C24H27Cl2N3O |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide |
| SMILES | CC(C)N1CCC(NC(=O)c2cc3ccccc3n2Cc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H27Cl2N3O/c1-16(2)28-9-7-21(8-10-28)27-24(30)23-13-18-5-3-4-6-22(18)29(23)15-17-11-19(25)14-20(26)12-17/h3-6,11-14,16,21H,7-10,15H2,1-2H3,(H,27,30) |
| InChIKey | XYPXJXNGUNXJSO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide?
The IUPAC name of 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide (CID 20801035) is 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide.
What is the SMILES notation for 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide?
The canonical SMILES for 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide is CC(C)N1CCC(NC(=O)c2cc3ccccc3n2Cc2cc(Cl)cc(Cl)c2)CC1.
What is the InChIKey of 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide?
The InChIKey is XYPXJXNGUNXJSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27Cl2N3O/c1-16(2)28-9-7-21(8-10-28)27-24(30)23-13-18-5-3-4-6-22(18)29(23)15-17-11-19(25)14-20(26)12-17/h3-6,11-14,16,21H,7-10,15H2,1-2H3,(H,27,30).
What are the key properties of 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide?
1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide has a molecular weight of 444.41 g/mol, XLogP of 5.60, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dichlorophenyl)methyl]-N-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide is sourced from PubChem (CID 20801035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).