C24H27N3O3 — CID 46491360
ethyl 4-[(1-benzylindole-2-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 46491360) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is ethyl 4-[(1-benzylindole-2-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(1-benzylindole-2-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46491360 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | ethyl 4-[(1-benzylindole-2-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cc3ccccc3n2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H27N3O3/c1-2-30-24(29)26-14-12-20(13-15-26)25-23(28)22-16-19-10-6-7-11-21(19)27(22)17-18-8-4-3-5-9-18/h3-11,16,20H,2,12-15,17H2,1H3,(H,25,28) |
| InChIKey | ABAIXJNXHQYWPZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |