C24H28ClN3O2 — CID 90309643
[1-[(3-chlorophenyl)methyl]indol-2-yl] N-(1-propan-2-ylpiperidin-4-yl)carbamate (PubChem CID 90309643) has the molecular formula C24H28ClN3O2 and a molecular weight of 425.96 g/mol. Its IUPAC name is [1-[(3-chlorophenyl)methyl]indol-2-yl] N-(1-propan-2-ylpiperidin-4-yl)carbamate.
| Compound Name | [1-[(3-chlorophenyl)methyl]indol-2-yl] N-(1-propan-2-ylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 90309643 |
| Molecular Formula | C24H28ClN3O2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | [1-[(3-chlorophenyl)methyl]indol-2-yl] N-(1-propan-2-ylpiperidin-4-yl)carbamate |
| SMILES | CC(C)N1CCC(NC(=O)Oc2cc3ccccc3n2Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H28ClN3O2/c1-17(2)27-12-10-21(11-13-27)26-24(29)30-23-15-19-7-3-4-9-22(19)28(23)16-18-6-5-8-20(25)14-18/h3-9,14-15,17,21H,10-13,16H2,1-2H3,(H,26,29) |
| InChIKey | YAYYHQIVTDQTLG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |