C32H32N2O2S — CID 177394867
N,N-dibenzyl-2-[3-methyl-1-(4-methylphenyl)sulfonylindol-2-yl]ethanamine (PubChem CID 177394867) has the molecular formula C32H32N2O2S and a molecular weight of 508.69 g/mol. Its IUPAC name is N,N-dibenzyl-2-[3-methyl-1-(4-methylphenyl)sulfonylindol-2-yl]ethanamine.
| Compound Name | N,N-dibenzyl-2-[3-methyl-1-(4-methylphenyl)sulfonylindol-2-yl]ethanamine |
|---|---|
| PubChem CID | 177394867 |
| Molecular Formula | C32H32N2O2S |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | N,N-dibenzyl-2-[3-methyl-1-(4-methylphenyl)sulfonylindol-2-yl]ethanamine |
| SMILES | Cc1ccc(S(=O)(=O)n2c(CCN(Cc3ccccc3)Cc3ccccc3)c(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C32H32N2O2S/c1-25-17-19-29(20-18-25)37(35,36)34-31(26(2)30-15-9-10-16-32(30)34)21-22-33(23-27-11-5-3-6-12-27)24-28-13-7-4-8-14-28/h3-20H,21-24H2,1-2H3 |
| InChIKey | OEOUQYULKYQSJL-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |