C25H23NO2S — CID 137395262
3-methyl-1-(4-methylphenyl)sulfonyl-2-[(1R,2S)-2-phenylcyclopropyl]indole (PubChem CID 137395262) has the molecular formula C25H23NO2S and a molecular weight of 401.53 g/mol. Its IUPAC name is 3-methyl-1-(4-methylphenyl)sulfonyl-2-[(1R,2S)-2-phenylcyclopropyl]indole.
| Compound Name | 3-methyl-1-(4-methylphenyl)sulfonyl-2-[(1R,2S)-2-phenylcyclopropyl]indole |
|---|---|
| PubChem CID | 137395262 |
| Molecular Formula | C25H23NO2S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-methyl-1-(4-methylphenyl)sulfonyl-2-[(1R,2S)-2-phenylcyclopropyl]indole |
| SMILES | Cc1ccc(S(=O)(=O)n2c([C@@H]3C[C@@H]3c3ccccc3)c(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H23NO2S/c1-17-12-14-20(15-13-17)29(27,28)26-24-11-7-6-10-21(24)18(2)25(26)23-16-22(23)19-8-4-3-5-9-19/h3-15,22-23H,16H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | MQTXVSJYAHUDHY-DHIUTWEWSA-N |
| XLogP | 5.77 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |