C22H22N2O3S — CID 11418003
(12bR)-12-(4-methylphenyl)sulfonyl-1,3,4,6,7,12b-hexahydroindolo[2,3-a]quinolizin-2-one (PubChem CID 11418003) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is (12bR)-12-(4-methylphenyl)sulfonyl-1,3,4,6,7,12b-hexahydroindolo[2,3-a]quinolizin-2-one.
| Compound Name | (12bR)-12-(4-methylphenyl)sulfonyl-1,3,4,6,7,12b-hexahydroindolo[2,3-a]quinolizin-2-one |
|---|---|
| PubChem CID | 11418003 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (12bR)-12-(4-methylphenyl)sulfonyl-1,3,4,6,7,12b-hexahydroindolo[2,3-a]quinolizin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)n2c3c(c4ccccc42)CCN2CCC(=O)C[C@H]32)cc1 |
| InChI | InChI=1S/C22H22N2O3S/c1-15-6-8-17(9-7-15)28(26,27)24-20-5-3-2-4-18(20)19-11-13-23-12-10-16(25)14-21(23)22(19)24/h2-9,21H,10-14H2,1H3/t21-/m1/s1 |
| InChIKey | UDVYHPLDFJBSMZ-OAQYLSRUSA-N |
| XLogP | 3.45 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |