C26H30N2O2S — CID 15953557
2-(2-methylidenebutyl)-9-(4-methylphenyl)sulfonyl-1-prop-2-enyl-3,4-dihydro-1H-pyrido[3,4-b]indole (PubChem CID 15953557) has the molecular formula C26H30N2O2S and a molecular weight of 434.61 g/mol. Its IUPAC name is 2-(2-methylidenebutyl)-9-(4-methylphenyl)sulfonyl-1-prop-2-enyl-3,4-dihydro-1H-pyrido[3,4-b]indole.
| Compound Name | 2-(2-methylidenebutyl)-9-(4-methylphenyl)sulfonyl-1-prop-2-enyl-3,4-dihydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 15953557 |
| Molecular Formula | C26H30N2O2S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-(2-methylidenebutyl)-9-(4-methylphenyl)sulfonyl-1-prop-2-enyl-3,4-dihydro-1H-pyrido[3,4-b]indole |
| SMILES | C=CCC1c2c(c3ccccc3n2S(=O)(=O)c2ccc(C)cc2)CCN1CC(=C)CC |
| InChI | InChI=1S/C26H30N2O2S/c1-5-9-25-26-23(16-17-27(25)18-19(3)6-2)22-10-7-8-11-24(22)28(26)31(29,30)21-14-12-20(4)13-15-21/h5,7-8,10-15,25H,1,3,6,9,16-18H2,2,4H3 |
| InChIKey | UDFHUOMHFVEIEF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|