C24H27BrN2O2S — CID 71431392
(3R,12bS)-3-(1-bromoethyl)-12-(4-methylphenyl)sulfonyl-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizine (PubChem CID 71431392) has the molecular formula C24H27BrN2O2S and a molecular weight of 487.46 g/mol. Its IUPAC name is (3R,12bS)-3-(1-bromoethyl)-12-(4-methylphenyl)sulfonyl-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizine.
| Compound Name | (3R,12bS)-3-(1-bromoethyl)-12-(4-methylphenyl)sulfonyl-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizine |
|---|---|
| PubChem CID | 71431392 |
| Molecular Formula | C24H27BrN2O2S |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | (3R,12bS)-3-(1-bromoethyl)-12-(4-methylphenyl)sulfonyl-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizine |
| SMILES | Cc1ccc(S(=O)(=O)n2c3c(c4ccccc42)CCN2C[C@H](C(C)Br)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C24H27BrN2O2S/c1-16-7-10-19(11-8-16)30(28,29)27-22-6-4-3-5-20(22)21-13-14-26-15-18(17(2)25)9-12-23(26)24(21)27/h3-8,10-11,17-18,23H,9,12-15H2,1-2H3/t17?,18-,23+/m1/s1 |
| InChIKey | YKPCSYZUBGHCIJ-GTGLXDFNSA-N |
| XLogP | 5.28 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|