C32H30N2O6S2 — CID 11072096
(1R,15R,20R)-15-(benzenesulfonyl)-3-(4-methylphenyl)sulfonyl-1,11,12,16,17,19,20,21-octahydroyohimban-14,18-dione (PubChem CID 11072096) has the molecular formula C32H30N2O6S2 and a molecular weight of 602.73 g/mol. Its IUPAC name is (1R,15R,20R)-15-(benzenesulfonyl)-3-(4-methylphenyl)sulfonyl-1,11,12,16,17,19,20,21-octahydroyohimban-14,18-dione.
| Compound Name | (1R,15R,20R)-15-(benzenesulfonyl)-3-(4-methylphenyl)sulfonyl-1,11,12,16,17,19,20,21-octahydroyohimban-14,18-dione |
|---|---|
| PubChem CID | 11072096 |
| Molecular Formula | C32H30N2O6S2 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | (1R,15R,20R)-15-(benzenesulfonyl)-3-(4-methylphenyl)sulfonyl-1,11,12,16,17,19,20,21-octahydroyohimban-14,18-dione |
| SMILES | Cc1ccc(S(=O)(=O)n2c3c(c4ccccc42)CCN2C(=O)[C@@]4(S(=O)(=O)c5ccccc5)CCC(=O)C[C@H]4C[C@H]32)cc1 |
| InChI | InChI=1S/C32H30N2O6S2/c1-21-11-13-25(14-12-21)42(39,40)34-28-10-6-5-9-26(28)27-16-18-33-29(30(27)34)20-22-19-23(35)15-17-32(22,31(33)36)41(37,38)24-7-3-2-4-8-24/h2-14,22,29H,15-20H2,1H3/t22-,29+,32+/m0/s1 |
| InChIKey | GZEMTIHLKAKQDU-ASDROINTSA-N |
| XLogP | 4.60 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |