C26H24ClNO2S — CID 139095266
(1R,3R,4S)-3-chloro-4-methyl-9-(4-methylphenyl)sulfonyl-1-phenyl-1,2,3,4-tetrahydrocarbazole (PubChem CID 139095266) has the molecular formula C26H24ClNO2S and a molecular weight of 450.00 g/mol. Its IUPAC name is (1R,3R,4S)-3-chloro-4-methyl-9-(4-methylphenyl)sulfonyl-1-phenyl-1,2,3,4-tetrahydrocarbazole.
| Compound Name | (1R,3R,4S)-3-chloro-4-methyl-9-(4-methylphenyl)sulfonyl-1-phenyl-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 139095266 |
| Molecular Formula | C26H24ClNO2S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | (1R,3R,4S)-3-chloro-4-methyl-9-(4-methylphenyl)sulfonyl-1-phenyl-1,2,3,4-tetrahydrocarbazole |
| SMILES | Cc1ccc(S(=O)(=O)n2c3c(c4ccccc42)[C@H](C)[C@H](Cl)C[C@@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24ClNO2S/c1-17-12-14-20(15-13-17)31(29,30)28-24-11-7-6-10-21(24)25-18(2)23(27)16-22(26(25)28)19-8-4-3-5-9-19/h3-15,18,22-23H,16H2,1-2H3/t18-,22-,23-/m1/s1 |
| InChIKey | NYNKCIHUVOYQRS-SXSPYAJSSA-N |
| XLogP | 6.43 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|