C22H21NO3S — CID 162413828
(1S,12R)-9-(4-methylphenyl)sulfonyl-9-azatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-15-one (PubChem CID 162413828) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is (1S,12R)-9-(4-methylphenyl)sulfonyl-9-azatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-15-one.
| Compound Name | (1S,12R)-9-(4-methylphenyl)sulfonyl-9-azatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-15-one |
|---|---|
| PubChem CID | 162413828 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (1S,12R)-9-(4-methylphenyl)sulfonyl-9-azatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-15-one |
| SMILES | Cc1ccc(S(=O)(=O)n2c3c(c4ccccc42)[C@@H]2C[C@@H](CCC2=O)C3)cc1 |
| InChI | InChI=1S/C22H21NO3S/c1-14-6-9-16(10-7-14)27(25,26)23-19-5-3-2-4-17(19)22-18-12-15(13-20(22)23)8-11-21(18)24/h2-7,9-10,15,18H,8,11-13H2,1H3/t15-,18-/m1/s1 |
| InChIKey | SCDGPJOTWSLSAG-CRAIPNDOSA-N |
| XLogP | 4.20 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |