C25H29NO3S — CID 73058213
4-[3-cyclohexyl-1-(4-methylphenyl)sulfonylindol-2-yl]butan-2-one (PubChem CID 73058213) has the molecular formula C25H29NO3S and a molecular weight of 423.58 g/mol. Its IUPAC name is 4-[3-cyclohexyl-1-(4-methylphenyl)sulfonylindol-2-yl]butan-2-one.
| Compound Name | 4-[3-cyclohexyl-1-(4-methylphenyl)sulfonylindol-2-yl]butan-2-one |
|---|---|
| PubChem CID | 73058213 |
| Molecular Formula | C25H29NO3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-[3-cyclohexyl-1-(4-methylphenyl)sulfonylindol-2-yl]butan-2-one |
| SMILES | CC(=O)CCc1c(C2CCCCC2)c2ccccc2n1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H29NO3S/c1-18-12-15-21(16-13-18)30(28,29)26-23-11-7-6-10-22(23)25(20-8-4-3-5-9-20)24(26)17-14-19(2)27/h6-7,10-13,15-16,20H,3-5,8-9,14,17H2,1-2H3 |
| InChIKey | WYYPKTWOPKOOTE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |