C22H20NO2PS — CID 175023681
[1-(4-methylphenyl)sulfonyl-3-phenylindol-2-yl]methylphosphane (PubChem CID 175023681) has the molecular formula C22H20NO2PS and a molecular weight of 393.45 g/mol. Its IUPAC name is [1-(4-methylphenyl)sulfonyl-3-phenylindol-2-yl]methylphosphane.
| Compound Name | [1-(4-methylphenyl)sulfonyl-3-phenylindol-2-yl]methylphosphane |
|---|---|
| PubChem CID | 175023681 |
| Molecular Formula | C22H20NO2PS |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | [1-(4-methylphenyl)sulfonyl-3-phenylindol-2-yl]methylphosphane |
| SMILES | Cc1ccc(S(=O)(=O)n2c(CP)c(-c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H20NO2PS/c1-16-11-13-18(14-12-16)27(24,25)23-20-10-6-5-9-19(20)22(21(23)15-26)17-7-3-2-4-8-17/h2-14H,15,26H2,1H3 |
| InChIKey | XOBRFLGYGDBCQL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|