C26H17Cl2NO2S — CID 15473667
1-(benzenesulfonyl)-2,3-bis(4-chlorophenyl)indole (PubChem CID 15473667) has the molecular formula C26H17Cl2NO2S and a molecular weight of 478.40 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2,3-bis(4-chlorophenyl)indole.
| Compound Name | 1-(benzenesulfonyl)-2,3-bis(4-chlorophenyl)indole |
|---|---|
| PubChem CID | 15473667 |
| Molecular Formula | C26H17Cl2NO2S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 1-(benzenesulfonyl)-2,3-bis(4-chlorophenyl)indole |
| SMILES | O=S(=O)(c1ccccc1)n1c(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C26H17Cl2NO2S/c27-20-14-10-18(11-15-20)25-23-8-4-5-9-24(23)29(26(25)19-12-16-21(28)17-13-19)32(30,31)22-6-2-1-3-7-22/h1-17H |
| InChIKey | BOKHLRCSAYKWSD-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |