C27H18ClF2NO2S — CID 132506395
2-(4-chlorophenyl)-5-fluoro-3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylindole (PubChem CID 132506395) has the molecular formula C27H18ClF2NO2S and a molecular weight of 493.96 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-fluoro-3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylindole.
| Compound Name | 2-(4-chlorophenyl)-5-fluoro-3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 132506395 |
| Molecular Formula | C27H18ClF2NO2S |
| Molecular Weight | 493.96 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 2-(4-chlorophenyl)-5-fluoro-3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylindole |
| SMILES | Cc1ccc(S(=O)(=O)n2c(-c3ccc(Cl)cc3)c(-c3ccc(F)cc3)c3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C27H18ClF2NO2S/c1-17-2-13-23(14-3-17)34(32,33)31-25-15-12-22(30)16-24(25)26(18-6-10-21(29)11-7-18)27(31)19-4-8-20(28)9-5-19/h2-16H,1H3 |
| InChIKey | UFOLIQIIMIZTFO-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.96 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |