C29H18ClFN2O4S2 — CID 156685586
2-[3-[1-(4-chlorophenyl)sulfonyl-5-fluoro-3-(2-isocyanothiophen-3-yl)indol-2-yl]phenyl]cyclopropane-1-carboxylic acid (PubChem CID 156685586) has the molecular formula C29H18ClFN2O4S2 and a molecular weight of 577.06 g/mol. Its IUPAC name is 2-[3-[1-(4-chlorophenyl)sulfonyl-5-fluoro-3-(2-isocyanothiophen-3-yl)indol-2-yl]phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[3-[1-(4-chlorophenyl)sulfonyl-5-fluoro-3-(2-isocyanothiophen-3-yl)indol-2-yl]phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 156685586 |
| Molecular Formula | C29H18ClFN2O4S2 |
| Molecular Weight | 577.06 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | 2-[3-[1-(4-chlorophenyl)sulfonyl-5-fluoro-3-(2-isocyanothiophen-3-yl)indol-2-yl]phenyl]cyclopropane-1-carboxylic acid |
| SMILES | [C-]#[N+]c1sccc1-c1c(-c2cccc(C3CC3C(=O)O)c2)n(S(=O)(=O)c2ccc(Cl)cc2)c2ccc(F)cc12 |
| InChI | InChI=1S/C29H18ClFN2O4S2/c1-32-28-21(11-12-38-28)26-24-14-19(31)7-10-25(24)33(39(36,37)20-8-5-18(30)6-9-20)27(26)17-4-2-3-16(13-17)22-15-23(22)29(34)35/h2-14,22-23H,15H2,(H,34,35) |
| InChIKey | BELPORGIDLKSLK-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.06 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|