C26H17ClN2O5S3 — CID 156685658
methyl 2-[1-(4-chlorophenyl)sulfonyl-3-(2-isocyanothiophen-3-yl)-2-thiophen-2-ylindol-5-yl]oxyacetate (PubChem CID 156685658) has the molecular formula C26H17ClN2O5S3 and a molecular weight of 569.09 g/mol. Its IUPAC name is methyl 2-[1-(4-chlorophenyl)sulfonyl-3-(2-isocyanothiophen-3-yl)-2-thiophen-2-ylindol-5-yl]oxyacetate.
| Compound Name | methyl 2-[1-(4-chlorophenyl)sulfonyl-3-(2-isocyanothiophen-3-yl)-2-thiophen-2-ylindol-5-yl]oxyacetate |
|---|---|
| PubChem CID | 156685658 |
| Molecular Formula | C26H17ClN2O5S3 |
| Molecular Weight | 569.09 g/mol |
| Exact Mass | 568.00 |
| IUPAC Name | methyl 2-[1-(4-chlorophenyl)sulfonyl-3-(2-isocyanothiophen-3-yl)-2-thiophen-2-ylindol-5-yl]oxyacetate |
| SMILES | [C-]#[N+]c1sccc1-c1c(-c2cccs2)n(S(=O)(=O)c2ccc(Cl)cc2)c2ccc(OCC(=O)OC)cc12 |
| InChI | InChI=1S/C26H17ClN2O5S3/c1-28-26-19(11-13-36-26)24-20-14-17(34-15-23(30)33-2)7-10-21(20)29(25(24)22-4-3-12-35-22)37(31,32)18-8-5-16(27)6-9-18/h3-14H,15H2,2H3 |
| InChIKey | PDSJZXAOQWWYPJ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 78.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.09 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|