C30H24N2O4S2 — CID 156685705
2-[3-[3-(2-isocyanothiophen-3-yl)-1-(4-methylphenyl)sulfonylindol-2-yl]phenyl]-2-methylpropanoic acid (PubChem CID 156685705) has the molecular formula C30H24N2O4S2 and a molecular weight of 540.67 g/mol. Its IUPAC name is 2-[3-[3-(2-isocyanothiophen-3-yl)-1-(4-methylphenyl)sulfonylindol-2-yl]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[3-[3-(2-isocyanothiophen-3-yl)-1-(4-methylphenyl)sulfonylindol-2-yl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 156685705 |
| Molecular Formula | C30H24N2O4S2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 2-[3-[3-(2-isocyanothiophen-3-yl)-1-(4-methylphenyl)sulfonylindol-2-yl]phenyl]-2-methylpropanoic acid |
| SMILES | [C-]#[N+]c1sccc1-c1c(-c2cccc(C(C)(C)C(=O)O)c2)n(S(=O)(=O)c2ccc(C)cc2)c2ccccc12 |
| InChI | InChI=1S/C30H24N2O4S2/c1-19-12-14-22(15-13-19)38(35,36)32-25-11-6-5-10-23(25)26(24-16-17-37-28(24)31-4)27(32)20-8-7-9-21(18-20)30(2,3)29(33)34/h5-18H,1-3H3,(H,33,34) |
| InChIKey | JWQFEUVTHILQAZ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|