C30H22FN3O4S2 — CID 156685669
1-[3-[5-fluoro-3-(3-isocyanothiophen-2-yl)-1-(4-methylphenyl)sulfonylindol-2-yl]phenyl]azetidine-3-carboxylic acid (PubChem CID 156685669) has the molecular formula C30H22FN3O4S2 and a molecular weight of 571.66 g/mol. Its IUPAC name is 1-[3-[5-fluoro-3-(3-isocyanothiophen-2-yl)-1-(4-methylphenyl)sulfonylindol-2-yl]phenyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[3-[5-fluoro-3-(3-isocyanothiophen-2-yl)-1-(4-methylphenyl)sulfonylindol-2-yl]phenyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 156685669 |
| Molecular Formula | C30H22FN3O4S2 |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | 1-[3-[5-fluoro-3-(3-isocyanothiophen-2-yl)-1-(4-methylphenyl)sulfonylindol-2-yl]phenyl]azetidine-3-carboxylic acid |
| SMILES | [C-]#[N+]c1ccsc1-c1c(-c2cccc(N3CC(C(=O)O)C3)c2)n(S(=O)(=O)c2ccc(C)cc2)c2ccc(F)cc12 |
| InChI | InChI=1S/C30H22FN3O4S2/c1-18-6-9-23(10-7-18)40(37,38)34-26-11-8-21(31)15-24(26)27(29-25(32-2)12-13-39-29)28(34)19-4-3-5-22(14-19)33-16-20(17-33)30(35)36/h3-15,20H,16-17H2,1H3,(H,35,36) |
| InChIKey | JMDUZGMPRJJXJB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|