C33H19ClF2N2O4S2 — CID 156685913
methyl 3-chloro-4-[3-[5-fluoro-1-(4-fluorophenyl)sulfonyl-3-(2-isocyanothiophen-3-yl)indol-2-yl]phenyl]benzoate (PubChem CID 156685913) has the molecular formula C33H19ClF2N2O4S2 and a molecular weight of 645.11 g/mol. Its IUPAC name is methyl 3-chloro-4-[3-[5-fluoro-1-(4-fluorophenyl)sulfonyl-3-(2-isocyanothiophen-3-yl)indol-2-yl]phenyl]benzoate.
| Compound Name | methyl 3-chloro-4-[3-[5-fluoro-1-(4-fluorophenyl)sulfonyl-3-(2-isocyanothiophen-3-yl)indol-2-yl]phenyl]benzoate |
|---|---|
| PubChem CID | 156685913 |
| Molecular Formula | C33H19ClF2N2O4S2 |
| Molecular Weight | 645.11 g/mol |
| Exact Mass | 644.04 |
| IUPAC Name | methyl 3-chloro-4-[3-[5-fluoro-1-(4-fluorophenyl)sulfonyl-3-(2-isocyanothiophen-3-yl)indol-2-yl]phenyl]benzoate |
| SMILES | [C-]#[N+]c1sccc1-c1c(-c2cccc(-c3ccc(C(=O)OC)cc3Cl)c2)n(S(=O)(=O)c2ccc(F)cc2)c2ccc(F)cc12 |
| InChI | InChI=1S/C33H19ClF2N2O4S2/c1-37-32-26(14-15-43-32)30-27-18-23(36)9-13-29(27)38(44(40,41)24-10-7-22(35)8-11-24)31(30)20-5-3-4-19(16-20)25-12-6-21(17-28(25)34)33(39)42-2/h3-18H,2H3 |
| InChIKey | KCGOUZTZFMBICE-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 69.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.11 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|