C37H22ClF2N3O4S — CID 159931012
2-[2-[3-(4-acetyl-2-chlorophenyl)phenyl]-1-[4-(difluoromethyl)phenyl]sulfonyl-5-hydroxyindol-3-yl]-3-isocyanobenzonitrile (PubChem CID 159931012) has the molecular formula C37H22ClF2N3O4S and a molecular weight of 678.12 g/mol. Its IUPAC name is 2-[2-[3-(4-acetyl-2-chlorophenyl)phenyl]-1-[4-(difluoromethyl)phenyl]sulfonyl-5-hydroxyindol-3-yl]-3-isocyanobenzonitrile.
| Compound Name | 2-[2-[3-(4-acetyl-2-chlorophenyl)phenyl]-1-[4-(difluoromethyl)phenyl]sulfonyl-5-hydroxyindol-3-yl]-3-isocyanobenzonitrile |
|---|---|
| PubChem CID | 159931012 |
| Molecular Formula | C37H22ClF2N3O4S |
| Molecular Weight | 678.12 g/mol |
| Exact Mass | 677.10 |
| IUPAC Name | 2-[2-[3-(4-acetyl-2-chlorophenyl)phenyl]-1-[4-(difluoromethyl)phenyl]sulfonyl-5-hydroxyindol-3-yl]-3-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-c1c(-c2cccc(-c3ccc(C(C)=O)cc3Cl)c2)n(S(=O)(=O)c2ccc(C(F)F)cc2)c2ccc(O)cc12 |
| InChI | InChI=1S/C37H22ClF2N3O4S/c1-21(44)23-11-15-29(31(38)18-23)24-5-3-6-25(17-24)36-35(34-26(20-41)7-4-8-32(34)42-2)30-19-27(45)12-16-33(30)43(36)48(46,47)28-13-9-22(10-14-28)37(39)40/h3-19,37,45H,1H3 |
| InChIKey | NZQFPHBQAMZCIH-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.12 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|