C37H21F4N3O4S — CID 156685545
methyl 4-[3-[3-(2-cyano-6-isocyanophenyl)-1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoroindol-2-yl]phenyl]-3-fluorobenzoate (PubChem CID 156685545) has the molecular formula C37H21F4N3O4S and a molecular weight of 679.65 g/mol. Its IUPAC name is methyl 4-[3-[3-(2-cyano-6-isocyanophenyl)-1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoroindol-2-yl]phenyl]-3-fluorobenzoate.
| Compound Name | methyl 4-[3-[3-(2-cyano-6-isocyanophenyl)-1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoroindol-2-yl]phenyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 156685545 |
| Molecular Formula | C37H21F4N3O4S |
| Molecular Weight | 679.65 g/mol |
| Exact Mass | 679.12 |
| IUPAC Name | methyl 4-[3-[3-(2-cyano-6-isocyanophenyl)-1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoroindol-2-yl]phenyl]-3-fluorobenzoate |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-c1c(-c2cccc(-c3ccc(C(=O)OC)cc3F)c2)n(S(=O)(=O)c2ccc(C(F)F)cc2)c2ccc(F)cc12 |
| InChI | InChI=1S/C37H21F4N3O4S/c1-43-31-8-4-7-25(20-42)33(31)34-29-19-26(38)12-16-32(29)44(49(46,47)27-13-9-21(10-14-27)36(40)41)35(34)23-6-3-5-22(17-23)28-15-11-24(18-30(28)39)37(45)48-2/h3-19,36H,2H3 |
| InChIKey | AMRWAKDCSTXZBQ-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.65 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|