C36H20ClF2N3O4S — CID 156685903
3-chloro-4-[3-[3-(2-cyano-6-isocyanophenyl)-1-[4-(difluoromethyl)phenyl]sulfonylindol-2-yl]phenyl]benzoic acid (PubChem CID 156685903) has the molecular formula C36H20ClF2N3O4S and a molecular weight of 664.09 g/mol. Its IUPAC name is 3-chloro-4-[3-[3-(2-cyano-6-isocyanophenyl)-1-[4-(difluoromethyl)phenyl]sulfonylindol-2-yl]phenyl]benzoic acid.
| Compound Name | 3-chloro-4-[3-[3-(2-cyano-6-isocyanophenyl)-1-[4-(difluoromethyl)phenyl]sulfonylindol-2-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 156685903 |
| Molecular Formula | C36H20ClF2N3O4S |
| Molecular Weight | 664.09 g/mol |
| Exact Mass | 663.08 |
| IUPAC Name | 3-chloro-4-[3-[3-(2-cyano-6-isocyanophenyl)-1-[4-(difluoromethyl)phenyl]sulfonylindol-2-yl]phenyl]benzoic acid |
| SMILES | [C-]#[N+]c1cccc(C#N)c1-c1c(-c2cccc(-c3ccc(C(=O)O)cc3Cl)c2)n(S(=O)(=O)c2ccc(C(F)F)cc2)c2ccccc12 |
| InChI | InChI=1S/C36H20ClF2N3O4S/c1-41-30-10-5-8-25(20-40)32(30)33-28-9-2-3-11-31(28)42(47(45,46)26-15-12-21(13-16-26)35(38)39)34(33)23-7-4-6-22(18-23)27-17-14-24(36(43)44)19-29(27)37/h2-19,35H,(H,43,44) |
| InChIKey | HWBFLLIBXLAOJK-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.09 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|