C35H23ClF3N3O6S3 — CID 156685616
2-[[3-chloro-4-[3-[1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoro-3-(2-isocyanothiophen-3-yl)indol-2-yl]phenyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 156685616) has the molecular formula C35H23ClF3N3O6S3 and a molecular weight of 770.23 g/mol. Its IUPAC name is 2-[[3-chloro-4-[3-[1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoro-3-(2-isocyanothiophen-3-yl)indol-2-yl]phenyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[3-chloro-4-[3-[1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoro-3-(2-isocyanothiophen-3-yl)indol-2-yl]phenyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 156685616 |
| Molecular Formula | C35H23ClF3N3O6S3 |
| Molecular Weight | 770.23 g/mol |
| Exact Mass | 769.04 |
| IUPAC Name | 2-[[3-chloro-4-[3-[1-[4-(difluoromethyl)phenyl]sulfonyl-5-fluoro-3-(2-isocyanothiophen-3-yl)indol-2-yl]phenyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | [C-]#[N+]c1sccc1-c1c(-c2cccc(-c3ccc(C(=O)NCCS(=O)(=O)O)cc3Cl)c2)n(S(=O)(=O)c2ccc(C(F)F)cc2)c2ccc(F)cc12 |
| InChI | InChI=1S/C35H23ClF3N3O6S3/c1-40-35-27(13-15-49-35)31-28-19-24(37)8-12-30(28)42(51(47,48)25-9-5-20(6-10-25)33(38)39)32(31)22-4-2-3-21(17-22)26-11-7-23(18-29(26)36)34(43)41-14-16-50(44,45)46/h2-13,15,17-19,33H,14,16H2,(H,41,43)(H,44,45,46) |
| InChIKey | OJDZEXALMFMDKR-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 126.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.23 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|