C33H21ClFN2O2PS2 — CID 170101088
methyl 3-chloro-4-[3-[3-(2-cyanothiophen-3-yl)-1-(4-fluorophenyl)sulfanyl-5-phosphanylindol-2-yl]phenyl]benzoate (PubChem CID 170101088) has the molecular formula C33H21ClFN2O2PS2 and a molecular weight of 627.10 g/mol. Its IUPAC name is methyl 3-chloro-4-[3-[3-(2-cyanothiophen-3-yl)-1-(4-fluorophenyl)sulfanyl-5-phosphanylindol-2-yl]phenyl]benzoate.
| Compound Name | methyl 3-chloro-4-[3-[3-(2-cyanothiophen-3-yl)-1-(4-fluorophenyl)sulfanyl-5-phosphanylindol-2-yl]phenyl]benzoate |
|---|---|
| PubChem CID | 170101088 |
| Molecular Formula | C33H21ClFN2O2PS2 |
| Molecular Weight | 627.10 g/mol |
| Exact Mass | 626.05 |
| IUPAC Name | methyl 3-chloro-4-[3-[3-(2-cyanothiophen-3-yl)-1-(4-fluorophenyl)sulfanyl-5-phosphanylindol-2-yl]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cccc(-c3c(-c4ccsc4C#N)c4cc(P)ccc4n3Sc3ccc(F)cc3)c2)c(Cl)c1 |
| InChI | InChI=1S/C33H21ClFN2O2PS2/c1-39-33(38)21-5-11-25(28(34)16-21)19-3-2-4-20(15-19)32-31(26-13-14-41-30(26)18-36)27-17-23(40)8-12-29(27)37(32)42-24-9-6-22(35)7-10-24/h2-17H,40H2,1H3 |
| InChIKey | KSLCNMINZVRSBF-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.10 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|