C26H20ClF2N3O4 — CID 87912989
methyl 3-chloro-4-[4-[[(2S)-1-[cyano(methyl)amino]-2-(2,6-difluorophenyl)-1-oxopropan-2-yl]carbamoyl]phenyl]benzoate (PubChem CID 87912989) has the molecular formula C26H20ClF2N3O4 and a molecular weight of 511.91 g/mol. Its IUPAC name is methyl 3-chloro-4-[4-[[(2S)-1-[cyano(methyl)amino]-2-(2,6-difluorophenyl)-1-oxopropan-2-yl]carbamoyl]phenyl]benzoate.
| Compound Name | methyl 3-chloro-4-[4-[[(2S)-1-[cyano(methyl)amino]-2-(2,6-difluorophenyl)-1-oxopropan-2-yl]carbamoyl]phenyl]benzoate |
|---|---|
| PubChem CID | 87912989 |
| Molecular Formula | C26H20ClF2N3O4 |
| Molecular Weight | 511.91 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | methyl 3-chloro-4-[4-[[(2S)-1-[cyano(methyl)amino]-2-(2,6-difluorophenyl)-1-oxopropan-2-yl]carbamoyl]phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C(=O)N[C@](C)(C(=O)N(C)C#N)c3c(F)cccc3F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C26H20ClF2N3O4/c1-26(25(35)32(2)14-30,22-20(28)5-4-6-21(22)29)31-23(33)16-9-7-15(8-10-16)18-12-11-17(13-19(18)27)24(34)36-3/h4-13H,1-3H3,(H,31,33)/t26-/m0/s1 |
| InChIKey | KSDPFISZBAIPDC-SANMLTNESA-N |
| XLogP | 4.66 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|