C14H8ClNO4S — CID 696453
methyl 2-(2-chlorothiophen-3-yl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 696453) has the molecular formula C14H8ClNO4S and a molecular weight of 321.74 g/mol. Its IUPAC name is methyl 2-(2-chlorothiophen-3-yl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | methyl 2-(2-chlorothiophen-3-yl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 696453 |
| Molecular Formula | C14H8ClNO4S |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | methyl 2-(2-chlorothiophen-3-yl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(=O)N(c1ccsc1Cl)C2=O |
| InChI | InChI=1S/C14H8ClNO4S/c1-20-14(19)7-2-3-8-9(6-7)13(18)16(12(8)17)10-4-5-21-11(10)15/h2-6H,1H3 |
| InChIKey | FSIICTYXGOKOHQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|