C15H9NO6S — CID 23852827
2-(2-methoxycarbonylthiophen-3-yl)-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 23852827) has the molecular formula C15H9NO6S and a molecular weight of 331.31 g/mol. Its IUPAC name is 2-(2-methoxycarbonylthiophen-3-yl)-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-(2-methoxycarbonylthiophen-3-yl)-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 23852827 |
| Molecular Formula | C15H9NO6S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-(2-methoxycarbonylthiophen-3-yl)-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | COC(=O)c1sccc1N1C(=O)c2ccc(C(=O)O)cc2C1=O |
| InChI | InChI=1S/C15H9NO6S/c1-22-15(21)11-10(4-5-23-11)16-12(17)8-3-2-7(14(19)20)6-9(8)13(16)18/h2-6H,1H3,(H,19,20) |
| InChIKey | LBFLHNWQVRHVDH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|