C14H9NO4S — CID 43345969
3-(5-methyl-1,3-dioxoisoindol-2-yl)thiophene-2-carboxylic acid (PubChem CID 43345969) has the molecular formula C14H9NO4S and a molecular weight of 287.30 g/mol. Its IUPAC name is 3-(5-methyl-1,3-dioxoisoindol-2-yl)thiophene-2-carboxylic acid.
| Compound Name | 3-(5-methyl-1,3-dioxoisoindol-2-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43345969 |
| Molecular Formula | C14H9NO4S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3-(5-methyl-1,3-dioxoisoindol-2-yl)thiophene-2-carboxylic acid |
| SMILES | Cc1ccc2c(c1)C(=O)N(c1ccsc1C(=O)O)C2=O |
| InChI | InChI=1S/C14H9NO4S/c1-7-2-3-8-9(6-7)13(17)15(12(8)16)10-4-5-20-11(10)14(18)19/h2-6H,1H3,(H,18,19) |
| InChIKey | BQPLUHPLUZNEID-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|