C15H11ClN2O2 — CID 43345930
2-(2-amino-5-chlorophenyl)-5-methylisoindole-1,3-dione (PubChem CID 43345930) has the molecular formula C15H11ClN2O2 and a molecular weight of 286.72 g/mol. Its IUPAC name is 2-(2-amino-5-chlorophenyl)-5-methylisoindole-1,3-dione.
| Compound Name | 2-(2-amino-5-chlorophenyl)-5-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 43345930 |
| Molecular Formula | C15H11ClN2O2 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-(2-amino-5-chlorophenyl)-5-methylisoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N(c1cc(Cl)ccc1N)C2=O |
| InChI | InChI=1S/C15H11ClN2O2/c1-8-2-4-10-11(6-8)15(20)18(14(10)19)13-7-9(16)3-5-12(13)17/h2-7H,17H2,1H3 |
| InChIKey | YSVWOYQAALXJLQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|