C16H11NO5 — CID 151179339
2-hydroxy-6-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid (PubChem CID 151179339) has the molecular formula C16H11NO5 and a molecular weight of 297.27 g/mol. Its IUPAC name is 2-hydroxy-6-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid.
| Compound Name | 2-hydroxy-6-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 151179339 |
| Molecular Formula | C16H11NO5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-hydroxy-6-(5-methyl-1,3-dioxoisoindol-2-yl)benzoic acid |
| SMILES | Cc1ccc2c(c1)C(=O)N(c1cccc(O)c1C(=O)O)C2=O |
| InChI | InChI=1S/C16H11NO5/c1-8-5-6-9-10(7-8)15(20)17(14(9)19)11-3-2-4-12(18)13(11)16(21)22/h2-7,18H,1H3,(H,21,22) |
| InChIKey | NDYOAYIABVXDMF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|